C23H32NO6PS — CID 138106746
[(1R,3S)-1-amino-3-[(6R)-6-[2-(thiophen-2-ylmethoxy)ethoxy]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate (PubChem CID 138106746) has the molecular formula C23H32NO6PS and a molecular weight of 481.55 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[(6R)-6-[2-(thiophen-2-ylmethoxy)ethoxy]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [(1R,3S)-1-amino-3-[(6R)-6-[2-(thiophen-2-ylmethoxy)ethoxy]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 138106746 |
| Molecular Formula | C23H32NO6PS |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | [(1R,3S)-1-amino-3-[(6R)-6-[2-(thiophen-2-ylmethoxy)ethoxy]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl dihydrogen phosphate |
| SMILES | N[C@]1(COP(=O)(O)O)CC[C@H](c2ccc3c(c2)CC[C@@H](OCCOCc2cccs2)C3)C1 |
| InChI | InChI=1S/C23H32NO6PS/c24-23(16-30-31(25,26)27)8-7-20(14-23)18-3-4-19-13-21(6-5-17(19)12-18)29-10-9-28-15-22-2-1-11-32-22/h1-4,11-12,20-21H,5-10,13-16,24H2,(H2,25,26,27)/t20-,21+,23+/m0/s1 |
| InChIKey | BHIHYIPPEVFATQ-QZNHQXDQSA-N |
| XLogP | 3.91 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|