C19H17ClN3O2- — CID 138107673
5-[[(1S,3S)-3-chlorocyclohexyl]amino]benzo[c][2,6]naphthyridine-8-carboxylate (PubChem CID 138107673) has the molecular formula C19H17ClN3O2- and a molecular weight of 354.82 g/mol. Its IUPAC name is 5-[[(1S,3S)-3-chlorocyclohexyl]amino]benzo[c][2,6]naphthyridine-8-carboxylate.
| Compound Name | 5-[[(1S,3S)-3-chlorocyclohexyl]amino]benzo[c][2,6]naphthyridine-8-carboxylate |
|---|---|
| PubChem CID | 138107673 |
| Molecular Formula | C19H17ClN3O2- |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 5-[[(1S,3S)-3-chlorocyclohexyl]amino]benzo[c][2,6]naphthyridine-8-carboxylate |
| SMILES | O=C([O-])c1ccc2c(c1)nc(N[C@H]1CCC[C@H](Cl)C1)c1ccncc12 |
| InChI | InChI=1S/C19H18ClN3O2/c20-12-2-1-3-13(9-12)22-18-15-6-7-21-10-16(15)14-5-4-11(19(24)25)8-17(14)23-18/h4-8,10,12-13H,1-3,9H2,(H,22,23)(H,24,25)/p-1/t12-,13-/m0/s1 |
| InChIKey | ZXPPUNRSOYMXSG-STQMWFEESA-M |
| XLogP | 3.11 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|