C22H33NO2 — CID 138108665
(1S,5R,9S,10S,11S,13R,14R,15S,16S)-7-ethyl-5-methyl-12-methylidene-7-azahexacyclo[7.6.2.210,13.01,8.05,16.010,15]nonadecane-11,14-diol (PubChem CID 138108665) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is (1S,5R,9S,10S,11S,13R,14R,15S,16S)-7-ethyl-5-methyl-12-methylidene-7-azahexacyclo[7.6.2.210,13.01,8.05,16.010,15]nonadecane-11,14-diol.
| Compound Name | (1S,5R,9S,10S,11S,13R,14R,15S,16S)-7-ethyl-5-methyl-12-methylidene-7-azahexacyclo[7.6.2.210,13.01,8.05,16.010,15]nonadecane-11,14-diol |
|---|---|
| PubChem CID | 138108665 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | (1S,5R,9S,10S,11S,13R,14R,15S,16S)-7-ethyl-5-methyl-12-methylidene-7-azahexacyclo[7.6.2.210,13.01,8.05,16.010,15]nonadecane-11,14-diol |
| SMILES | C=C1[C@H]2CC[C@@]3([C@@H]4C[C@H]5[C@@]6(C)CCC[C@@]5(C4N(CC)C6)[C@@H]3[C@@H]2O)[C@H]1O |
| InChI | InChI=1S/C22H33NO2/c1-4-23-11-20(3)7-5-8-22-15(20)10-14(18(22)23)21-9-6-13(12(2)19(21)25)16(24)17(21)22/h13-19,24-25H,2,4-11H2,1,3H3/t13-,14-,15+,16-,17-,18?,19+,20+,21+,22+/m1/s1 |
| InChIKey | OVXLNQAYPUEDSI-WCHWFFSYSA-N |
| XLogP | 2.82 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|