C10H8BrFO2 — CID 138109935
7-bromo-5-fluoro-4-methoxy-2,3-dihydroinden-1-one (PubChem CID 138109935) has the molecular formula C10H8BrFO2 and a molecular weight of 259.07 g/mol. Its IUPAC name is 7-bromo-5-fluoro-4-methoxy-2,3-dihydroinden-1-one.
| Compound Name | 7-bromo-5-fluoro-4-methoxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 138109935 |
| Molecular Formula | C10H8BrFO2 |
| Molecular Weight | 259.07 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | 7-bromo-5-fluoro-4-methoxy-2,3-dihydroinden-1-one |
| SMILES | COc1c(F)cc(Br)c2c1CCC2=O |
| InChI | InChI=1S/C10H8BrFO2/c1-14-10-5-2-3-8(13)9(5)6(11)4-7(10)12/h4H,2-3H2,1H3 |
| InChIKey | DIXVXEWVIIBCJG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.07 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |