C18H23BO5 — CID 138111128
2-methoxy-3-[(1S,2R,6S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]benzoic acid (PubChem CID 138111128) has the molecular formula C18H23BO5 and a molecular weight of 330.19 g/mol. Its IUPAC name is 2-methoxy-3-[(1S,2R,6S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]benzoic acid.
| Compound Name | 2-methoxy-3-[(1S,2R,6S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]benzoic acid |
|---|---|
| PubChem CID | 138111128 |
| Molecular Formula | C18H23BO5 |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-methoxy-3-[(1S,2R,6S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]benzoic acid |
| SMILES | COc1c(B2O[C@H]3C[C@@H]4C[C@@H](C4(C)C)[C@@]3(C)O2)cccc1C(=O)O |
| InChI | InChI=1S/C18H23BO5/c1-17(2)10-8-13(17)18(3)14(9-10)23-19(24-18)12-7-5-6-11(16(20)21)15(12)22-4/h5-7,10,13-14H,8-9H2,1-4H3,(H,20,21)/t10-,13-,14-,18+/m0/s1 |
| InChIKey | FKIKOMSSIGWQQZ-CQDXQUMASA-N |
| XLogP | 2.33 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|