C18H16N3O2- — CID 138111234
2-[1-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)ethylideneamino]benzoate (PubChem CID 138111234) has the molecular formula C18H16N3O2- and a molecular weight of 306.35 g/mol. Its IUPAC name is 2-[1-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)ethylideneamino]benzoate.
| Compound Name | 2-[1-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)ethylideneamino]benzoate |
|---|---|
| PubChem CID | 138111234 |
| Molecular Formula | C18H16N3O2- |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-[1-(2,7-dimethylimidazo[1,2-a]pyridin-3-yl)ethylideneamino]benzoate |
| SMILES | C/C(=N\c1ccccc1C(=O)[O-])c1c(C)nc2cc(C)ccn12 |
| InChI | InChI=1S/C18H17N3O2/c1-11-8-9-21-16(10-11)20-13(3)17(21)12(2)19-15-7-5-4-6-14(15)18(22)23/h4-10H,1-3H3,(H,22,23)/p-1/b19-12+ |
| InChIKey | VTQQZTHDGXPLEE-XDHOZWIPSA-M |
| XLogP | 2.46 |
| TPSA | 69.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|