About 1-(3,4-dichlorophenyl)-4-(1-phenylethyl)piperazine;dihydrochloride
1-(3,4-dichlorophenyl)-4-(1-phenylethyl)piperazine;dihydrochloride (PubChem CID 138111695) has the molecular formula C18H22Cl4N2
and a molecular weight of 408.20 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-4-(1-phenylethyl)piperazine;dihydrochloride.
Molecular Properties
| Compound Name | 1-(3,4-dichlorophenyl)-4-(1-phenylethyl)piperazine;dihydrochloride |
| PubChem CID | 138111695 |
| Molecular Formula | C18H22Cl4N2 |
| Molecular Weight | 408.20 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-4-(1-phenylethyl)piperazine;dihydrochloride |
| SMILES | CC(c1ccccc1)N1CCN(c2ccc(Cl)c(Cl)c2)CC1.Cl.Cl |
| InChI | InChI=1S/C18H20Cl2N2.2ClH/c1-14(15-5-3-2-4-6-15)21-9-11-22(12-10-21)16-7-8-17(19)18(20)13-16;;/h2-8,13-14H,9-12H2,1H3;2*1H |
| InChIKey | XHFCMXQWOFQXKZ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.20 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,4-dichlorophenyl)-4-(1-phenylethyl)piperazine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dichlorophenyl)-4-(1-phenylethyl)piperazine;dihydrochloride?
The IUPAC name of 1-(3,4-dichlorophenyl)-4-(1-phenylethyl)piperazine;dihydrochloride (CID 138111695) is 1-(3,4-dichlorophenyl)-4-(1-phenylethyl)piperazine;dihydrochloride.
What is the SMILES notation for 1-(3,4-dichlorophenyl)-4-(1-phenylethyl)piperazine;dihydrochloride?
The canonical SMILES for 1-(3,4-dichlorophenyl)-4-(1-phenylethyl)piperazine;dihydrochloride is CC(c1ccccc1)N1CCN(c2ccc(Cl)c(Cl)c2)CC1.Cl.Cl.
What is the InChIKey of 1-(3,4-dichlorophenyl)-4-(1-phenylethyl)piperazine;dihydrochloride?
The InChIKey is XHFCMXQWOFQXKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20Cl2N2.2ClH/c1-14(15-5-3-2-4-6-15)21-9-11-22(12-10-21)16-7-8-17(19)18(20)13-16;;/h2-8,13-14H,9-12H2,1H3;2*1H.
What are the key properties of 1-(3,4-dichlorophenyl)-4-(1-phenylethyl)piperazine;dihydrochloride?
1-(3,4-dichlorophenyl)-4-(1-phenylethyl)piperazine;dihydrochloride has a molecular weight of 408.20 g/mol, XLogP of 5.72, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dichlorophenyl)-4-(1-phenylethyl)piperazine;dihydrochloride is sourced from PubChem (CID 138111695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).