About ethyl 2-bromo-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylate
ethyl 2-bromo-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 138112799) has the molecular formula C9H8BrN3O4
and a molecular weight of 302.08 g/mol. Its IUPAC name is ethyl 2-bromo-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-bromo-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylate |
| PubChem CID | 138112799 |
| Molecular Formula | C9H8BrN3O4 |
| Molecular Weight | 302.08 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | ethyl 2-bromo-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1C(=O)Nc2cc(Br)nn2C1=O |
| InChI | InChI=1S/C9H8BrN3O4/c1-2-17-9(16)6-7(14)11-5-3-4(10)12-13(5)8(6)15/h3,6H,2H2,1H3,(H,11,14) |
| InChIKey | ALWMPPBTBOZRKO-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.08 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-bromo-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-bromo-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylate?
The IUPAC name of ethyl 2-bromo-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylate (CID 138112799) is ethyl 2-bromo-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylate.
What is the SMILES notation for ethyl 2-bromo-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylate?
The canonical SMILES for ethyl 2-bromo-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylate is CCOC(=O)C1C(=O)Nc2cc(Br)nn2C1=O.
What is the InChIKey of ethyl 2-bromo-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylate?
The InChIKey is ALWMPPBTBOZRKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrN3O4/c1-2-17-9(16)6-7(14)11-5-3-4(10)12-13(5)8(6)15/h3,6H,2H2,1H3,(H,11,14).
What are the key properties of ethyl 2-bromo-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylate?
ethyl 2-bromo-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylate has a molecular weight of 302.08 g/mol, XLogP of 0.42, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-bromo-5,7-dioxo-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylate is sourced from PubChem (CID 138112799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).