About furo[3,2-c]quinoline-2,4-dione
furo[3,2-c]quinoline-2,4-dione (PubChem CID 138115457) has the molecular formula C11H5NO3
and a molecular weight of 199.16 g/mol. Its IUPAC name is furo[3,2-c]quinoline-2,4-dione.
Molecular Properties
| Compound Name | furo[3,2-c]quinoline-2,4-dione |
| PubChem CID | 138115457 |
| Molecular Formula | C11H5NO3 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.03 |
| IUPAC Name | furo[3,2-c]quinoline-2,4-dione |
| SMILES | O=C1C=C2C(=O)N=c3ccccc3=C2O1 |
| InChI | InChI=1S/C11H5NO3/c13-9-5-7-10(15-9)6-3-1-2-4-8(6)12-11(7)14/h1-5H |
| InChIKey | RIFQDICADFVKQX-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furo[3,2-c]quinoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furo[3,2-c]quinoline-2,4-dione?
The IUPAC name of furo[3,2-c]quinoline-2,4-dione (CID 138115457) is furo[3,2-c]quinoline-2,4-dione.
What is the SMILES notation for furo[3,2-c]quinoline-2,4-dione?
The canonical SMILES for furo[3,2-c]quinoline-2,4-dione is O=C1C=C2C(=O)N=c3ccccc3=C2O1.
What is the InChIKey of furo[3,2-c]quinoline-2,4-dione?
The InChIKey is RIFQDICADFVKQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5NO3/c13-9-5-7-10(15-9)6-3-1-2-4-8(6)12-11(7)14/h1-5H.
What are the key properties of furo[3,2-c]quinoline-2,4-dione?
furo[3,2-c]quinoline-2,4-dione has a molecular weight of 199.16 g/mol, XLogP of -0.56, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furo[3,2-c]quinoline-2,4-dione is sourced from PubChem (CID 138115457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).