C9H12N2O3Se — CID 138115462
1-[(2S,5R)-5-(hydroxymethyl)selenolan-2-yl]pyrimidine-2,4-dione (PubChem CID 138115462) has the molecular formula C9H12N2O3Se and a molecular weight of 275.17 g/mol. Its IUPAC name is 1-[(2S,5R)-5-(hydroxymethyl)selenolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2S,5R)-5-(hydroxymethyl)selenolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 138115462 |
| Molecular Formula | C9H12N2O3Se |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | 1-[(2S,5R)-5-(hydroxymethyl)selenolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2CC[C@H](CO)[Se]2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H12N2O3Se/c12-5-6-1-2-8(15-6)11-4-3-7(13)10-9(11)14/h3-4,6,8,12H,1-2,5H2,(H,10,13,14)/t6-,8+/m1/s1 |
| InChIKey | WFRJZDQHVBXOLF-SVRRBLITSA-N |
| XLogP | -0.69 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|