C14H12O3S — CID 138115519
2-methyl-4-phenyl-4a,7a-dihydro-4H-thiopyrano[2,3-c]furan-5,7-dione (PubChem CID 138115519) has the molecular formula C14H12O3S and a molecular weight of 260.31 g/mol. Its IUPAC name is 2-methyl-4-phenyl-4a,7a-dihydro-4H-thiopyrano[2,3-c]furan-5,7-dione.
| Compound Name | 2-methyl-4-phenyl-4a,7a-dihydro-4H-thiopyrano[2,3-c]furan-5,7-dione |
|---|---|
| PubChem CID | 138115519 |
| Molecular Formula | C14H12O3S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 2-methyl-4-phenyl-4a,7a-dihydro-4H-thiopyrano[2,3-c]furan-5,7-dione |
| SMILES | CC1=CC(c2ccccc2)C2C(=O)OC(=O)C2S1 |
| InChI | InChI=1S/C14H12O3S/c1-8-7-10(9-5-3-2-4-6-9)11-12(18-8)14(16)17-13(11)15/h2-7,10-12H,1H3 |
| InChIKey | IMFSULBQAUTDAC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|