C19H15N3O4 — CID 138115653
1-(cinnamylideneamino)-3a,8b-dihydroxy-3H-indeno[1,2-d]imidazole-2,4-dione (PubChem CID 138115653) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is 1-(cinnamylideneamino)-3a,8b-dihydroxy-3H-indeno[1,2-d]imidazole-2,4-dione.
| Compound Name | 1-(cinnamylideneamino)-3a,8b-dihydroxy-3H-indeno[1,2-d]imidazole-2,4-dione |
|---|---|
| PubChem CID | 138115653 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 1-(cinnamylideneamino)-3a,8b-dihydroxy-3H-indeno[1,2-d]imidazole-2,4-dione |
| SMILES | O=C1NC2(O)C(=O)c3ccccc3C2(O)N1N=CC=Cc1ccccc1 |
| InChI | InChI=1S/C19H15N3O4/c23-16-14-10-4-5-11-15(14)19(26)18(16,25)21-17(24)22(19)20-12-6-9-13-7-2-1-3-8-13/h1-12,25-26H,(H,21,24) |
| InChIKey | XNVUQXAUACILFY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|