C21H30O12 — CID 138115719
[(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxy-7-(acetyloxymethyl)-8-deuteriooct-7-enyl] acetate (PubChem CID 138115719) has the molecular formula C21H30O12 and a molecular weight of 475.47 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxy-7-(acetyloxymethyl)-8-deuteriooct-7-enyl] acetate.
| Compound Name | [(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxy-7-(acetyloxymethyl)-8-deuteriooct-7-enyl] acetate |
|---|---|
| PubChem CID | 138115719 |
| Molecular Formula | C21H30O12 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | [(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxy-7-(acetyloxymethyl)-8-deuteriooct-7-enyl] acetate |
| SMILES | [2H]/C=C(\COC(C)=O)C[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C21H30O12/c1-11(9-28-12(2)22)8-18(30-14(4)24)20(32-16(6)26)21(33-17(7)27)19(31-15(5)25)10-29-13(3)23/h18-21H,1,8-10H2,2-7H3/t18-,19+,20+,21+/m0/s1/i1D/b11-1- |
| InChIKey | XJXDKMGENFJBQE-FVQUYANYSA-N |
| XLogP | 0.79 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|