About 3-(1,3-diphenylpyrazol-4-yl)-1-[6-(trifluoromethyl)-1-benzofuran-2-yl]prop-2-en-1-one
3-(1,3-diphenylpyrazol-4-yl)-1-[6-(trifluoromethyl)-1-benzofuran-2-yl]prop-2-en-1-one (PubChem CID 138115724) has the molecular formula C27H17F3N2O2
and a molecular weight of 458.44 g/mol. Its IUPAC name is 3-(1,3-diphenylpyrazol-4-yl)-1-[6-(trifluoromethyl)-1-benzofuran-2-yl]prop-2-en-1-one.
Molecular Properties
| Compound Name | 3-(1,3-diphenylpyrazol-4-yl)-1-[6-(trifluoromethyl)-1-benzofuran-2-yl]prop-2-en-1-one |
| PubChem CID | 138115724 |
| Molecular Formula | C27H17F3N2O2 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 3-(1,3-diphenylpyrazol-4-yl)-1-[6-(trifluoromethyl)-1-benzofuran-2-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1cn(-c2ccccc2)nc1-c1ccccc1)c1cc2ccc(C(F)(F)F)cc2o1 |
| InChI | InChI=1S/C27H17F3N2O2/c28-27(29,30)21-13-11-19-15-25(34-24(19)16-21)23(33)14-12-20-17-32(22-9-5-2-6-10-22)31-26(20)18-7-3-1-4-8-18/h1-17H |
| InChIKey | OSNJUFSETHQJRO-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-diphenylpyrazol-4-yl)-1-[6-(trifluoromethyl)-1-benzofuran-2-yl]prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-diphenylpyrazol-4-yl)-1-[6-(trifluoromethyl)-1-benzofuran-2-yl]prop-2-en-1-one?
The IUPAC name of 3-(1,3-diphenylpyrazol-4-yl)-1-[6-(trifluoromethyl)-1-benzofuran-2-yl]prop-2-en-1-one (CID 138115724) is 3-(1,3-diphenylpyrazol-4-yl)-1-[6-(trifluoromethyl)-1-benzofuran-2-yl]prop-2-en-1-one.
What is the SMILES notation for 3-(1,3-diphenylpyrazol-4-yl)-1-[6-(trifluoromethyl)-1-benzofuran-2-yl]prop-2-en-1-one?
The canonical SMILES for 3-(1,3-diphenylpyrazol-4-yl)-1-[6-(trifluoromethyl)-1-benzofuran-2-yl]prop-2-en-1-one is O=C(C=Cc1cn(-c2ccccc2)nc1-c1ccccc1)c1cc2ccc(C(F)(F)F)cc2o1.
What is the InChIKey of 3-(1,3-diphenylpyrazol-4-yl)-1-[6-(trifluoromethyl)-1-benzofuran-2-yl]prop-2-en-1-one?
The InChIKey is OSNJUFSETHQJRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H17F3N2O2/c28-27(29,30)21-13-11-19-15-25(34-24(19)16-21)23(33)14-12-20-17-32(22-9-5-2-6-10-22)31-26(20)18-7-3-1-4-8-18/h1-17H.
What are the key properties of 3-(1,3-diphenylpyrazol-4-yl)-1-[6-(trifluoromethyl)-1-benzofuran-2-yl]prop-2-en-1-one?
3-(1,3-diphenylpyrazol-4-yl)-1-[6-(trifluoromethyl)-1-benzofuran-2-yl]prop-2-en-1-one has a molecular weight of 458.44 g/mol, XLogP of 7.20, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-diphenylpyrazol-4-yl)-1-[6-(trifluoromethyl)-1-benzofuran-2-yl]prop-2-en-1-one is sourced from PubChem (CID 138115724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).