C48H18F8N4O8 — CID 138115788
5-[15-(1,3-dioxo-2-benzofuran-5-yl)-10,20-bis(2,3,5,6-tetrafluoro-4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]-2-benzofuran-1,3-dione (PubChem CID 138115788) has the molecular formula C48H18F8N4O8 and a molecular weight of 930.68 g/mol. Its IUPAC name is 5-[15-(1,3-dioxo-2-benzofuran-5-yl)-10,20-bis(2,3,5,6-tetrafluoro-4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]-2-benzofuran-1,3-dione.
| Compound Name | 5-[15-(1,3-dioxo-2-benzofuran-5-yl)-10,20-bis(2,3,5,6-tetrafluoro-4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 138115788 |
| Molecular Formula | C48H18F8N4O8 |
| Molecular Weight | 930.68 g/mol |
| Exact Mass | 930.10 |
| IUPAC Name | 5-[15-(1,3-dioxo-2-benzofuran-5-yl)-10,20-bis(2,3,5,6-tetrafluoro-4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(-c3c4nc(c(-c5c(F)c(F)c(O)c(F)c5F)c5ccc([nH]5)c(-c5ccc6c(c5)C(=O)OC6=O)c5nc(c(-c6c(F)c(F)c(O)c(F)c6F)c6ccc3[nH]6)C=C5)C=C4)ccc21 |
| InChI | InChI=1S/C48H18F8N4O8/c49-35-33(36(50)40(54)43(61)39(35)53)31-25-9-5-21(57-25)29(15-1-3-17-19(13-15)47(65)67-45(17)63)22-6-10-26(58-22)32(34-37(51)41(55)44(62)42(56)38(34)52)28-12-8-24(60-28)30(23-7-11-27(31)59-23)16-2-4-18-20(14-16)48(66)68-46(18)64/h1-14,57,60-62H/b29-21-,29-22-,30-23-,30-24-,31-25+,31-27+,32-26+,32-28+ |
| InChIKey | LMZUIQRJOOCESN-IBRKNYKGSA-N |
| XLogP | 10.47 |
| TPSA | 184.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.68 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|