C22H20N2O5 — CID 1381160
1,3-dibenzoyl-5,5-diethyl-1,3-diazinane-2,4,6-trione (PubChem CID 1381160) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is 1,3-dibenzoyl-5,5-diethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dibenzoyl-5,5-diethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1381160 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 1,3-dibenzoyl-5,5-diethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(CC)C(=O)N(C(=O)c2ccccc2)C(=O)N(C(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C22H20N2O5/c1-3-22(4-2)19(27)23(17(25)15-11-7-5-8-12-15)21(29)24(20(22)28)18(26)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3 |
| InChIKey | LIXBKNSBPHNDKL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|