C43H84NO7P — CID 138118781
[2-[(Z)-heptadec-9-enoyl]oxy-3-[(Z)-octadec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138118781) has the molecular formula C43H84NO7P and a molecular weight of 758.12 g/mol. Its IUPAC name is [2-[(Z)-heptadec-9-enoyl]oxy-3-[(Z)-octadec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [2-[(Z)-heptadec-9-enoyl]oxy-3-[(Z)-octadec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138118781 |
| Molecular Formula | C43H84NO7P |
| Molecular Weight | 758.12 g/mol |
| Exact Mass | 757.60 |
| IUPAC Name | [2-[(Z)-heptadec-9-enoyl]oxy-3-[(Z)-octadec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCC/C=C\CCCCCCCC(=O)OC(COCCCCCCCC/C=C\CCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C43H84NO7P/c1-6-8-10-12-14-16-18-20-22-23-25-27-29-31-33-35-38-48-40-42(41-50-52(46,47)49-39-37-44(3,4)5)51-43(45)36-34-32-30-28-26-24-21-19-17-15-13-11-9-7-2/h19-22,42H,6-18,23-41H2,1-5H3/b21-19-,22-20- |
| InChIKey | AJJZHKMUBRMLBW-WRBBJXAJSA-N |
| XLogP | 11.81 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.12 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|