C40H73NO4 — CID 138123220
(Z)-N-[(4E,8E,12E)-1,3-dihydroxyhenicosa-4,8,12-trien-2-yl]-2-hydroxynonadec-9-enamide (PubChem CID 138123220) has the molecular formula C40H73NO4 and a molecular weight of 632.03 g/mol. Its IUPAC name is (Z)-N-[(4E,8E,12E)-1,3-dihydroxyhenicosa-4,8,12-trien-2-yl]-2-hydroxynonadec-9-enamide.
| Compound Name | (Z)-N-[(4E,8E,12E)-1,3-dihydroxyhenicosa-4,8,12-trien-2-yl]-2-hydroxynonadec-9-enamide |
|---|---|
| PubChem CID | 138123220 |
| Molecular Formula | C40H73NO4 |
| Molecular Weight | 632.03 g/mol |
| Exact Mass | 631.55 |
| IUPAC Name | (Z)-N-[(4E,8E,12E)-1,3-dihydroxyhenicosa-4,8,12-trien-2-yl]-2-hydroxynonadec-9-enamide |
| SMILES | CCCCCCCC/C=C/CC/C=C/CC/C=C/C(O)C(CO)NC(=O)C(O)CCCCCC/C=C\CCCCCCCCC |
| InChI | InChI=1S/C40H73NO4/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-34-38(43)37(36-42)41-40(45)39(44)35-33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h17,19-20,23-24,26,32,34,37-39,42-44H,3-16,18,21-22,25,27-31,33,35-36H2,1-2H3,(H,41,45)/b19-17+,23-20-,26-24+,34-32+ |
| InChIKey | AXFALWTYXOBKNF-RNUUQZDOSA-N |
| XLogP | 10.20 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.03 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|