C39H75N2O6P — CID 138124626
[(4E,8E)-3-hydroxy-2-[[(Z)-nonadec-9-enoyl]amino]pentadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138124626) has the molecular formula C39H75N2O6P and a molecular weight of 699.01 g/mol. Its IUPAC name is [(4E,8E)-3-hydroxy-2-[[(Z)-nonadec-9-enoyl]amino]pentadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(4E,8E)-3-hydroxy-2-[[(Z)-nonadec-9-enoyl]amino]pentadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138124626 |
| Molecular Formula | C39H75N2O6P |
| Molecular Weight | 699.01 g/mol |
| Exact Mass | 698.54 |
| IUPAC Name | [(4E,8E)-3-hydroxy-2-[[(Z)-nonadec-9-enoyl]amino]pentadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCC/C=C/CC/C=C/C(O)C(COP(=O)([O-])OCC[N+](C)(C)C)NC(=O)CCCCCCC/C=C\CCCCCCCCC |
| InChI | InChI=1S/C39H75N2O6P/c1-6-8-10-12-14-16-18-19-20-21-22-23-25-27-29-31-33-39(43)40-37(36-47-48(44,45)46-35-34-41(3,4)5)38(42)32-30-28-26-24-17-15-13-11-9-7-2/h17,20-21,24,30,32,37-38,42H,6-16,18-19,22-23,25-29,31,33-36H2,1-5H3,(H-,40,43,44,45)/b21-20-,24-17+,32-30+ |
| InChIKey | BBMOYSGUSHWACK-GAEIZYPSSA-N |
| XLogP | 9.33 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.01 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|