C15H29O8P — CID 138126690
(1-acetyloxy-3-phosphonooxypropan-2-yl) decanoate (PubChem CID 138126690) has the molecular formula C15H29O8P and a molecular weight of 368.36 g/mol. Its IUPAC name is (1-acetyloxy-3-phosphonooxypropan-2-yl) decanoate.
| Compound Name | (1-acetyloxy-3-phosphonooxypropan-2-yl) decanoate |
|---|---|
| PubChem CID | 138126690 |
| Molecular Formula | C15H29O8P |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (1-acetyloxy-3-phosphonooxypropan-2-yl) decanoate |
| SMILES | CCCCCCCCCC(=O)OC(COC(C)=O)COP(=O)(O)O |
| InChI | InChI=1S/C15H29O8P/c1-3-4-5-6-7-8-9-10-15(17)23-14(11-21-13(2)16)12-22-24(18,19)20/h14H,3-12H2,1-2H3,(H2,18,19,20) |
| InChIKey | BHXRCRMPZVVHFO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|