C45H80O15 — CID 138128412
[1-nonanoyloxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate (PubChem CID 138128412) has the molecular formula C45H80O15 and a molecular weight of 861.12 g/mol. Its IUPAC name is [1-nonanoyloxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate.
| Compound Name | [1-nonanoyloxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate |
|---|---|
| PubChem CID | 138128412 |
| Molecular Formula | C45H80O15 |
| Molecular Weight | 861.12 g/mol |
| Exact Mass | 860.55 |
| IUPAC Name | [1-nonanoyloxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate |
| SMILES | CCCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC(COC(=O)CCCCCCCC)COC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C45H80O15/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-22-24-26-28-37(48)58-33(30-55-36(47)27-25-23-10-8-6-4-2)31-56-44-43(54)41(52)39(50)35(60-44)32-57-45-42(53)40(51)38(49)34(29-46)59-45/h12-13,15-16,33-35,38-46,49-54H,3-11,14,17-32H2,1-2H3/b13-12-,16-15- |
| InChIKey | BNKFVWJXOHUPQO-QGLGPCELSA-N |
| XLogP | 4.82 |
| TPSA | 231.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.12 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|