C48H84O6 — CID 138129030
[2-[(Z)-tetradec-9-enoyl]oxy-3-[(Z)-tridec-8-enoyl]oxypropyl] (10Z,12Z)-octadeca-10,12-dienoate (PubChem CID 138129030) has the molecular formula C48H84O6 and a molecular weight of 757.19 g/mol. Its IUPAC name is [2-[(Z)-tetradec-9-enoyl]oxy-3-[(Z)-tridec-8-enoyl]oxypropyl] (10Z,12Z)-octadeca-10,12-dienoate.
| Compound Name | [2-[(Z)-tetradec-9-enoyl]oxy-3-[(Z)-tridec-8-enoyl]oxypropyl] (10Z,12Z)-octadeca-10,12-dienoate |
|---|---|
| PubChem CID | 138129030 |
| Molecular Formula | C48H84O6 |
| Molecular Weight | 757.19 g/mol |
| Exact Mass | 756.63 |
| IUPAC Name | [2-[(Z)-tetradec-9-enoyl]oxy-3-[(Z)-tridec-8-enoyl]oxypropyl] (10Z,12Z)-octadeca-10,12-dienoate |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCCC/C=C\CCCC)COC(=O)CCCCCCCC/C=C\C=C/CCCCC |
| InChI | InChI=1S/C48H84O6/c1-4-7-10-13-16-19-22-23-24-25-27-29-32-35-38-41-47(50)53-44-45(43-52-46(49)40-37-34-31-28-21-18-15-12-9-6-3)54-48(51)42-39-36-33-30-26-20-17-14-11-8-5-2/h14-19,22-23,45H,4-13,20-21,24-44H2,1-3H3/b17-14-,18-15-,19-16-,23-22- |
| InChIKey | BPINPMVJPHNNPA-BBYWYKQHSA-N |
| XLogP | 14.36 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.19 |
| LogP ≤ 5 | 14.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|