C62H115O11P — CID 138129675
[3-[hydroxy-[3-hydroxy-2-[(Z)-octadec-9-enoyl]oxypropoxy]phosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-icos-11-enoate (PubChem CID 138129675) has the molecular formula C62H115O11P and a molecular weight of 1067.56 g/mol. Its IUPAC name is [3-[hydroxy-[3-hydroxy-2-[(Z)-octadec-9-enoyl]oxypropoxy]phosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-icos-11-enoate.
| Compound Name | [3-[hydroxy-[3-hydroxy-2-[(Z)-octadec-9-enoyl]oxypropoxy]phosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-icos-11-enoate |
|---|---|
| PubChem CID | 138129675 |
| Molecular Formula | C62H115O11P |
| Molecular Weight | 1067.56 g/mol |
| Exact Mass | 1066.82 |
| IUPAC Name | [3-[hydroxy-[3-hydroxy-2-[(Z)-octadec-9-enoyl]oxypropoxy]phosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-icos-11-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(CO)OC(=O)CCCCCCC/C=C\CCCCCCCC)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C62H115O11P/c1-4-7-10-13-16-19-22-25-28-29-32-33-36-39-42-45-48-51-60(64)69-55-59(73-62(66)53-50-47-44-41-38-35-31-27-24-21-18-15-12-9-6-3)57-71-74(67,68)70-56-58(54-63)72-61(65)52-49-46-43-40-37-34-30-26-23-20-17-14-11-8-5-2/h25-28,30-31,58-59,63H,4-24,29,32-57H2,1-3H3,(H,67,68)/b28-25-,30-26-,31-27- |
| InChIKey | BRHYAQQNEVWZDC-DCKNSECYSA-N |
| XLogP | 18.37 |
| TPSA | 154.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 58 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1067.56 |
| LogP ≤ 5 | 18.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|