C39H68NO7P — CID 138131294
[3-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoxy]-2-nonanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138131294) has the molecular formula C39H68NO7P and a molecular weight of 693.95 g/mol. Its IUPAC name is [3-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoxy]-2-nonanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [3-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoxy]-2-nonanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138131294 |
| Molecular Formula | C39H68NO7P |
| Molecular Weight | 693.95 g/mol |
| Exact Mass | 693.47 |
| IUPAC Name | [3-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoxy]-2-nonanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC |
| InChI | InChI=1S/C39H68NO7P/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-23-24-25-26-27-29-31-34-44-36-38(47-39(41)32-30-28-13-11-9-7-2)37-46-48(42,43)45-35-33-40(3,4)5/h8,10,14-15,17-18,20-21,23-24,26-27,38H,6-7,9,11-13,16,19,22,25,28-37H2,1-5H3/b10-8-,15-14-,18-17-,21-20-,24-23-,27-26- |
| InChIKey | BWFCUMHIRXZLLQ-MSXCAIDTSA-N |
| XLogP | 9.35 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.95 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|