C51H80O6 — CID 138135956
[3-[(Z)-dodec-5-enoyl]oxy-2-[(9Z,11Z,13Z,15Z)-octadeca-9,11,13,15-tetraenoyl]oxypropyl] (9Z,11Z,13Z,15Z)-octadeca-9,11,13,15-tetraenoate (PubChem CID 138135956) has the molecular formula C51H80O6 and a molecular weight of 789.20 g/mol. Its IUPAC name is [3-[(Z)-dodec-5-enoyl]oxy-2-[(9Z,11Z,13Z,15Z)-octadeca-9,11,13,15-tetraenoyl]oxypropyl] (9Z,11Z,13Z,15Z)-octadeca-9,11,13,15-tetraenoate.
| Compound Name | [3-[(Z)-dodec-5-enoyl]oxy-2-[(9Z,11Z,13Z,15Z)-octadeca-9,11,13,15-tetraenoyl]oxypropyl] (9Z,11Z,13Z,15Z)-octadeca-9,11,13,15-tetraenoate |
|---|---|
| PubChem CID | 138135956 |
| Molecular Formula | C51H80O6 |
| Molecular Weight | 789.20 g/mol |
| Exact Mass | 788.60 |
| IUPAC Name | [3-[(Z)-dodec-5-enoyl]oxy-2-[(9Z,11Z,13Z,15Z)-octadeca-9,11,13,15-tetraenoyl]oxypropyl] (9Z,11Z,13Z,15Z)-octadeca-9,11,13,15-tetraenoate |
| SMILES | CC/C=C\C=C/C=C\C=C/CCCCCCCC(=O)OCC(COC(=O)CCC/C=C\CCCCCC)OC(=O)CCCCCCC/C=C\C=C/C=C\C=C/CC |
| InChI | InChI=1S/C51H80O6/c1-4-7-10-13-16-19-21-23-25-27-29-32-35-38-41-44-50(53)56-47-48(46-55-49(52)43-40-37-34-31-18-15-12-9-6-3)57-51(54)45-42-39-36-33-30-28-26-24-22-20-17-14-11-8-5-2/h7-8,10-11,13-14,16-17,19-26,31,34,48H,4-6,9,12,15,18,27-30,32-33,35-47H2,1-3H3/b10-7-,11-8-,16-13-,17-14-,21-19-,22-20-,25-23-,26-24-,34-31- |
| InChIKey | CKPOPSMPUTZTLQ-HSKKYBBESA-N |
| XLogP | 14.41 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.20 |
| LogP ≤ 5 | 14.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|