About 4-[2,6-bis(4-aminophenyl)pyrimidin-4-yl]aniline
4-[2,6-bis(4-aminophenyl)pyrimidin-4-yl]aniline (PubChem CID 1381395) has the molecular formula C22H19N5
and a molecular weight of 353.43 g/mol. Its IUPAC name is 4-[2,6-bis(4-aminophenyl)pyrimidin-4-yl]aniline.
Molecular Properties
| Compound Name | 4-[2,6-bis(4-aminophenyl)pyrimidin-4-yl]aniline |
| PubChem CID | 1381395 |
| Molecular Formula | C22H19N5 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 4-[2,6-bis(4-aminophenyl)pyrimidin-4-yl]aniline |
| SMILES | Nc1ccc(-c2cc(-c3ccc(N)cc3)nc(-c3ccc(N)cc3)n2)cc1 |
| InChI | InChI=1S/C22H19N5/c23-17-7-1-14(2-8-17)20-13-21(15-3-9-18(24)10-4-15)27-22(26-20)16-5-11-19(25)12-6-16/h1-13H,23-25H2 |
| InChIKey | OQDMEZSPCAZIQE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,6-bis(4-aminophenyl)pyrimidin-4-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,6-bis(4-aminophenyl)pyrimidin-4-yl]aniline?
The IUPAC name of 4-[2,6-bis(4-aminophenyl)pyrimidin-4-yl]aniline (CID 1381395) is 4-[2,6-bis(4-aminophenyl)pyrimidin-4-yl]aniline.
What is the SMILES notation for 4-[2,6-bis(4-aminophenyl)pyrimidin-4-yl]aniline?
The canonical SMILES for 4-[2,6-bis(4-aminophenyl)pyrimidin-4-yl]aniline is Nc1ccc(-c2cc(-c3ccc(N)cc3)nc(-c3ccc(N)cc3)n2)cc1.
What is the InChIKey of 4-[2,6-bis(4-aminophenyl)pyrimidin-4-yl]aniline?
The InChIKey is OQDMEZSPCAZIQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N5/c23-17-7-1-14(2-8-17)20-13-21(15-3-9-18(24)10-4-15)27-22(26-20)16-5-11-19(25)12-6-16/h1-13H,23-25H2.
What are the key properties of 4-[2,6-bis(4-aminophenyl)pyrimidin-4-yl]aniline?
4-[2,6-bis(4-aminophenyl)pyrimidin-4-yl]aniline has a molecular weight of 353.43 g/mol, XLogP of 4.22, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,6-bis(4-aminophenyl)pyrimidin-4-yl]aniline is sourced from PubChem (CID 1381395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).