C12H8N2O2S2 — CID 1381463
3-(4-hydroxy-2-sulfanylidene-3H-1,3-thiazol-5-yl)-5-methylindol-2-one (PubChem CID 1381463) has the molecular formula C12H8N2O2S2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-(4-hydroxy-2-sulfanylidene-3H-1,3-thiazol-5-yl)-5-methylindol-2-one.
| Compound Name | 3-(4-hydroxy-2-sulfanylidene-3H-1,3-thiazol-5-yl)-5-methylindol-2-one |
|---|---|
| PubChem CID | 1381463 |
| Molecular Formula | C12H8N2O2S2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | 3-(4-hydroxy-2-sulfanylidene-3H-1,3-thiazol-5-yl)-5-methylindol-2-one |
| SMILES | Cc1ccc2c(c1)=C(c1sc(=S)[nH]c1O)C(=O)N=2 |
| InChI | InChI=1S/C12H8N2O2S2/c1-5-2-3-7-6(4-5)8(10(15)13-7)9-11(16)14-12(17)18-9/h2-4,16H,1H3,(H,14,17) |
| InChIKey | QCBQQONGDTWEPX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 65.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|