C14H10ClN3OS2 — CID 1381466
(5Z)-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 1381466) has the molecular formula C14H10ClN3OS2 and a molecular weight of 335.84 g/mol. Its IUPAC name is (5Z)-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1381466 |
| Molecular Formula | C14H10ClN3OS2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | (5Z)-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1/C=C1\SC(=S)NC1=O |
| InChI | InChI=1S/C14H10ClN3OS2/c1-8-10(7-11-13(19)16-14(20)21-11)12(15)18(17-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,16,19,20)/b11-7- |
| InChIKey | GZGZRNVWFMRFIZ-XFFZJAGNSA-N |
| XLogP | 3.32 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|