C29H50NO4+ — CID 138149190
[3-carboxy-2-[(10E,13E,16E,19E)-docosa-10,13,16,19-tetraenoyl]oxypropyl]-trimethylazanium (PubChem CID 138149190) has the molecular formula C29H50NO4+ and a molecular weight of 476.72 g/mol. Its IUPAC name is [3-carboxy-2-[(10E,13E,16E,19E)-docosa-10,13,16,19-tetraenoyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(10E,13E,16E,19E)-docosa-10,13,16,19-tetraenoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 138149190 |
| Molecular Formula | C29H50NO4+ |
| Molecular Weight | 476.72 g/mol |
| Exact Mass | 476.37 |
| IUPAC Name | [3-carboxy-2-[(10E,13E,16E,19E)-docosa-10,13,16,19-tetraenoyl]oxypropyl]-trimethylazanium |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/CCCCCCCCC(=O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C29H49NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-29(33)34-27(25-28(31)32)26-30(2,3)4/h6-7,9-10,12-13,15-16,27H,5,8,11,14,17-26H2,1-4H3/p+1/b7-6+,10-9+,13-12+,16-15+ |
| InChIKey | DZMCTWIUTJHPSM-CGRWFSSPSA-O |
| XLogP | 7.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.72 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|