C30H54O4 — CID 138152124
7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid (PubChem CID 138152124) has the molecular formula C30H54O4 and a molecular weight of 478.76 g/mol. Its IUPAC name is 7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid.
| Compound Name | 7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid |
|---|---|
| PubChem CID | 138152124 |
| Molecular Formula | C30H54O4 |
| Molecular Weight | 478.76 g/mol |
| Exact Mass | 478.40 |
| IUPAC Name | 7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid |
| SMILES | CCCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(CCCC)CCCCCC(=O)O |
| InChI | InChI=1S/C30H54O4/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-23-27-30(33)34-28(24-6-4-2)25-21-20-22-26-29(31)32/h10-11,13-14,28H,3-9,12,15-27H2,1-2H3,(H,31,32)/b11-10-,14-13- |
| InChIKey | FIIOAQTYSCHNNK-XVTLYKPTSA-N |
| XLogP | 9.33 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.76 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|