7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid

C30H54O4 — CID 138152124

IUPAC7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid
SMILESCCCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(CCCC)CCCCCC(=O)O
InChIInChI=1S/C30H54O4/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-23-27-30(33)34-28(24-6-4-2)25-21-20-22-26-29(31)32/h10-11,13-14,28H,3-9,12,15-27H2,1-2H3,(H,31,32)/b11-10-,14-13-
InChIKeyFIIOAQTYSCHNNK-XVTLYKPTSA-N
MW478.76 g/mol
LogP9.33
Rot. Bonds25

About 7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid

7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid (PubChem CID 138152124) has the molecular formula C30H54O4 and a molecular weight of 478.76 g/mol. Its IUPAC name is 7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid.

Molecular Properties

Compound Name7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid
PubChem CID138152124
Molecular FormulaC30H54O4
Molecular Weight478.76 g/mol
Exact Mass478.40
IUPAC Name7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid
SMILESCCCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(CCCC)CCCCCC(=O)O
InChIInChI=1S/C30H54O4/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-23-27-30(33)34-28(24-6-4-2)25-21-20-22-26-29(31)32/h10-11,13-14,28H,3-9,12,15-27H2,1-2H3,(H,31,32)/b11-10-,14-13-
InChIKeyFIIOAQTYSCHNNK-XVTLYKPTSA-N
XLogP9.33
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds25
Heavy Atoms34
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500478.76
LogP ≤ 59.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid?
The IUPAC name of 7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid (CID 138152124) is 7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid.
What is the SMILES notation for 7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid?
The canonical SMILES for 7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid is CCCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(CCCC)CCCCCC(=O)O.
What is the InChIKey of 7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid?
The InChIKey is FIIOAQTYSCHNNK-XVTLYKPTSA-N. The full InChI is InChI=1S/C30H54O4/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-23-27-30(33)34-28(24-6-4-2)25-21-20-22-26-29(31)32/h10-11,13-14,28H,3-9,12,15-27H2,1-2H3,(H,31,32)/b11-10-,14-13-.
What are the key properties of 7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid?
7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid has a molecular weight of 478.76 g/mol, XLogP of 9.33, 25 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyundecanoic acid is sourced from PubChem (CID 138152124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).