C44H79NO8 — CID 138156778
(Z)-N-[(4E,8E,12E)-3-hydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxydocosa-4,8,12-trien-2-yl]hexadec-7-enamide (PubChem CID 138156778) has the molecular formula C44H79NO8 and a molecular weight of 750.11 g/mol. Its IUPAC name is (Z)-N-[(4E,8E,12E)-3-hydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxydocosa-4,8,12-trien-2-yl]hexadec-7-enamide.
| Compound Name | (Z)-N-[(4E,8E,12E)-3-hydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxydocosa-4,8,12-trien-2-yl]hexadec-7-enamide |
|---|---|
| PubChem CID | 138156778 |
| Molecular Formula | C44H79NO8 |
| Molecular Weight | 750.11 g/mol |
| Exact Mass | 749.58 |
| IUPAC Name | (Z)-N-[(4E,8E,12E)-3-hydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxydocosa-4,8,12-trien-2-yl]hexadec-7-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCC(=O)NC(COC1OC(CO)C(O)C(O)C1O)C(O)/C=C/CC/C=C/CC/C=C/CCCCCCCCC |
| InChI | InChI=1S/C44H79NO8/c1-3-5-7-9-11-13-15-17-18-19-20-22-23-25-27-29-31-33-38(47)37(36-52-44-43(51)42(50)41(49)39(35-46)53-44)45-40(48)34-32-30-28-26-24-21-16-14-12-10-8-6-4-2/h18-19,21,23-25,31,33,37-39,41-44,46-47,49-51H,3-17,20,22,26-30,32,34-36H2,1-2H3,(H,45,48)/b19-18+,24-21-,25-23+,33-31+ |
| InChIKey | FWYAHAAWTRIRCH-MYQGFQRLSA-N |
| XLogP | 8.28 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.11 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|