C35H66NO10P — CID 138163401
2-amino-3-[hydroxy-[2-[(Z)-octadec-9-enoyl]oxy-3-undecanoyloxypropoxy]phosphoryl]oxypropanoic acid (PubChem CID 138163401) has the molecular formula C35H66NO10P and a molecular weight of 691.88 g/mol. Its IUPAC name is 2-amino-3-[hydroxy-[2-[(Z)-octadec-9-enoyl]oxy-3-undecanoyloxypropoxy]phosphoryl]oxypropanoic acid.
| Compound Name | 2-amino-3-[hydroxy-[2-[(Z)-octadec-9-enoyl]oxy-3-undecanoyloxypropoxy]phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 138163401 |
| Molecular Formula | C35H66NO10P |
| Molecular Weight | 691.88 g/mol |
| Exact Mass | 691.44 |
| IUPAC Name | 2-amino-3-[hydroxy-[2-[(Z)-octadec-9-enoyl]oxy-3-undecanoyloxypropoxy]phosphoryl]oxypropanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC)COP(=O)(O)OCC(N)C(=O)O |
| InChI | InChI=1S/C35H66NO10P/c1-3-5-7-9-11-13-14-15-16-17-18-19-21-23-25-27-34(38)46-31(29-44-47(41,42)45-30-32(36)35(39)40)28-43-33(37)26-24-22-20-12-10-8-6-4-2/h15-16,31-32H,3-14,17-30,36H2,1-2H3,(H,39,40)(H,41,42)/b16-15- |
| InChIKey | GRPGVSWYOOZSGA-NXVVXOECSA-N |
| XLogP | 8.56 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.88 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|