C40H69O8P — CID 138171557
[1-[(Z)-hexadec-9-enoyl]oxy-3-[hydroxy(methoxy)phosphoryl]oxypropan-2-yl] (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate (PubChem CID 138171557) has the molecular formula C40H69O8P and a molecular weight of 708.96 g/mol. Its IUPAC name is [1-[(Z)-hexadec-9-enoyl]oxy-3-[hydroxy(methoxy)phosphoryl]oxypropan-2-yl] (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate.
| Compound Name | [1-[(Z)-hexadec-9-enoyl]oxy-3-[hydroxy(methoxy)phosphoryl]oxypropan-2-yl] (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate |
|---|---|
| PubChem CID | 138171557 |
| Molecular Formula | C40H69O8P |
| Molecular Weight | 708.96 g/mol |
| Exact Mass | 708.47 |
| IUPAC Name | [1-[(Z)-hexadec-9-enoyl]oxy-3-[hydroxy(methoxy)phosphoryl]oxypropan-2-yl] (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)OC(COC(=O)CCCCCCC/C=C\CCCCCC)COP(=O)(O)OC |
| InChI | InChI=1S/C40H69O8P/c1-4-6-8-10-12-14-16-18-19-20-21-23-25-27-29-31-33-35-40(42)48-38(37-47-49(43,44)45-3)36-46-39(41)34-32-30-28-26-24-22-17-15-13-11-9-7-5-2/h6,8,12,14-15,17-19,21,23,38H,4-5,7,9-11,13,16,20,22,24-37H2,1-3H3,(H,43,44)/b8-6-,14-12-,17-15-,19-18-,23-21- |
| InChIKey | HRECMROEKICFFN-DHSYBHLNSA-N |
| XLogP | 11.61 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.96 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|