C46H90N2O6P+ — CID 138174326
2-[[(4E,8E)-2-[[(Z)-docos-11-enoyl]amino]-3-hydroxynonadeca-4,8-dienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 138174326) has the molecular formula C46H90N2O6P+ and a molecular weight of 798.21 g/mol. Its IUPAC name is 2-[[(4E,8E)-2-[[(Z)-docos-11-enoyl]amino]-3-hydroxynonadeca-4,8-dienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(4E,8E)-2-[[(Z)-docos-11-enoyl]amino]-3-hydroxynonadeca-4,8-dienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138174326 |
| Molecular Formula | C46H90N2O6P+ |
| Molecular Weight | 798.21 g/mol |
| Exact Mass | 797.65 |
| IUPAC Name | 2-[[(4E,8E)-2-[[(Z)-docos-11-enoyl]amino]-3-hydroxynonadeca-4,8-dienoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCCCC/C=C\CCCCCCCCCC(=O)NC(COP(=O)(O)OCC[N+](C)(C)C)C(O)/C=C/CC/C=C/CCCCCCCCCC |
| InChI | InChI=1S/C46H89N2O6P/c1-6-8-10-12-14-16-18-20-22-23-24-25-26-28-30-32-34-36-38-40-46(50)47-44(43-54-55(51,52)53-42-41-48(3,4)5)45(49)39-37-35-33-31-29-27-21-19-17-15-13-11-9-7-2/h23-24,29,31,37,39,44-45,49H,6-22,25-28,30,32-36,38,40-43H2,1-5H3,(H-,47,50,51,52)/p+1/b24-23-,31-29+,39-37+ |
| InChIKey | HZQIVMPGNWRDPA-XCDRWYSCSA-O |
| XLogP | 12.69 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.21 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|