C33H66NO7P — CID 138176332
[3-[(Z)-hexadec-9-enoxy]-2-nonanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138176332) has the molecular formula C33H66NO7P and a molecular weight of 619.87 g/mol. Its IUPAC name is [3-[(Z)-hexadec-9-enoxy]-2-nonanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [3-[(Z)-hexadec-9-enoxy]-2-nonanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138176332 |
| Molecular Formula | C33H66NO7P |
| Molecular Weight | 619.87 g/mol |
| Exact Mass | 619.46 |
| IUPAC Name | [3-[(Z)-hexadec-9-enoxy]-2-nonanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCC/C=C\CCCCCCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC |
| InChI | InChI=1S/C33H66NO7P/c1-6-8-10-12-14-15-16-17-18-19-20-21-23-25-28-38-30-32(41-33(35)26-24-22-13-11-9-7-2)31-40-42(36,37)39-29-27-34(3,4)5/h15-16,32H,6-14,17-31H2,1-5H3/b16-15- |
| InChIKey | IFVHLXAXZWQNSO-NXVVXOECSA-N |
| XLogP | 8.13 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.87 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|