C35H68NO8P — CID 138176999
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-decanoyloxypropan-2-yl] (Z)-icos-11-enoate (PubChem CID 138176999) has the molecular formula C35H68NO8P and a molecular weight of 661.90 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-decanoyloxypropan-2-yl] (Z)-icos-11-enoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-decanoyloxypropan-2-yl] (Z)-icos-11-enoate |
|---|---|
| PubChem CID | 138176999 |
| Molecular Formula | C35H68NO8P |
| Molecular Weight | 661.90 g/mol |
| Exact Mass | 661.47 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-decanoyloxypropan-2-yl] (Z)-icos-11-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C35H68NO8P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-24-26-28-35(38)44-33(32-43-45(39,40)42-30-29-36)31-41-34(37)27-25-23-21-10-8-6-4-2/h14-15,33H,3-13,16-32,36H2,1-2H3,(H,39,40)/b15-14- |
| InChIKey | IIAJEODNOLQDOK-PFONDFGASA-N |
| XLogP | 9.49 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.90 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|