C39H66O12S — CID 138178608
[6-[2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid (PubChem CID 138178608) has the molecular formula C39H66O12S and a molecular weight of 759.01 g/mol. Its IUPAC name is [6-[2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid.
| Compound Name | [6-[2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 138178608 |
| Molecular Formula | C39H66O12S |
| Molecular Weight | 759.01 g/mol |
| Exact Mass | 758.43 |
| IUPAC Name | [6-[2-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(COC(=O)CCCCCCC/C=C\CCCC)COC1OC(CS(=O)(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C39H66O12S/c1-3-5-7-9-11-13-15-16-18-20-22-24-26-28-35(41)50-32(29-48-34(40)27-25-23-21-19-17-14-12-10-8-6-4-2)30-49-39-38(44)37(43)36(42)33(51-39)31-52(45,46)47/h5,7,10-13,16,18,32-33,36-39,42-44H,3-4,6,8-9,14-15,17,19-31H2,1-2H3,(H,45,46,47)/b7-5-,12-10-,13-11-,18-16- |
| InChIKey | IMXUVADIGSAQNB-WBGHLPHUSA-N |
| XLogP | 6.44 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.01 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|