C24H44O10 — CID 138179413
[1-hexanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] nonanoate (PubChem CID 138179413) has the molecular formula C24H44O10 and a molecular weight of 492.61 g/mol. Its IUPAC name is [1-hexanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] nonanoate.
| Compound Name | [1-hexanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] nonanoate |
|---|---|
| PubChem CID | 138179413 |
| Molecular Formula | C24H44O10 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | [1-hexanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] nonanoate |
| SMILES | CCCCCCCCC(=O)OC(COC(=O)CCCCC)COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C24H44O10/c1-3-5-7-8-9-11-13-20(27)33-17(15-31-19(26)12-10-6-4-2)16-32-24-23(30)22(29)21(28)18(14-25)34-24/h17-18,21-25,28-30H,3-16H2,1-2H3 |
| InChIKey | IPLQIXGJWDJMJM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|