C31H53O10P — CID 138181634
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-pentanoyloxypropan-2-yl] (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate (PubChem CID 138181634) has the molecular formula C31H53O10P and a molecular weight of 616.73 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-pentanoyloxypropan-2-yl] (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-pentanoyloxypropan-2-yl] (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate |
|---|---|
| PubChem CID | 138181634 |
| Molecular Formula | C31H53O10P |
| Molecular Weight | 616.73 g/mol |
| Exact Mass | 616.34 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-pentanoyloxypropan-2-yl] (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)OC(COC(=O)CCCC)COP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C31H53O10P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-31(35)41-29(26-38-30(34)22-6-4-2)27-40-42(36,37)39-25-28(33)24-32/h5,7,9-10,12-13,15-16,28-29,32-33H,3-4,6,8,11,14,17-27H2,1-2H3,(H,36,37)/b7-5-,10-9-,13-12-,16-15- |
| InChIKey | IWCSGZQYPKYRSZ-KUXGPOOQSA-N |
| XLogP | 6.26 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.73 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|