C47H86O15 — CID 138185334
[1-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-3-undecanoyloxypropan-2-yl] (Z)-henicos-11-enoate (PubChem CID 138185334) has the molecular formula C47H86O15 and a molecular weight of 891.19 g/mol. Its IUPAC name is [1-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-3-undecanoyloxypropan-2-yl] (Z)-henicos-11-enoate.
| Compound Name | [1-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-3-undecanoyloxypropan-2-yl] (Z)-henicos-11-enoate |
|---|---|
| PubChem CID | 138185334 |
| Molecular Formula | C47H86O15 |
| Molecular Weight | 891.19 g/mol |
| Exact Mass | 890.60 |
| IUPAC Name | [1-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-3-undecanoyloxypropan-2-yl] (Z)-henicos-11-enoate |
| SMILES | CCCCCCCCC/C=C\CCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC)COC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C47H86O15/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-21-22-24-26-28-30-39(50)60-35(32-57-38(49)29-27-25-23-12-10-8-6-4-2)33-58-46-45(56)43(54)41(52)37(62-46)34-59-47-44(55)42(53)40(51)36(31-48)61-47/h16-17,35-37,40-48,51-56H,3-15,18-34H2,1-2H3/b17-16- |
| InChIKey | JHXQRBQNWHZSFF-MSUUIHNZSA-N |
| XLogP | 5.82 |
| TPSA | 231.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 62 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.19 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|