C43H81NO8 — CID 138186961
(Z)-N-[(E)-3-hydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentadec-4-en-2-yl]docos-11-enamide (PubChem CID 138186961) has the molecular formula C43H81NO8 and a molecular weight of 740.12 g/mol. Its IUPAC name is (Z)-N-[(E)-3-hydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentadec-4-en-2-yl]docos-11-enamide.
| Compound Name | (Z)-N-[(E)-3-hydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentadec-4-en-2-yl]docos-11-enamide |
|---|---|
| PubChem CID | 138186961 |
| Molecular Formula | C43H81NO8 |
| Molecular Weight | 740.12 g/mol |
| Exact Mass | 739.60 |
| IUPAC Name | (Z)-N-[(E)-3-hydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentadec-4-en-2-yl]docos-11-enamide |
| SMILES | CCCCCCCCCC/C=C\CCCCCCCCCC(=O)NC(COC1OC(CO)C(O)C(O)C1O)C(O)/C=C/CCCCCCCCCC |
| InChI | InChI=1S/C43H81NO8/c1-3-5-7-9-11-13-15-16-17-18-19-20-21-22-23-25-27-29-31-33-39(47)44-36(35-51-43-42(50)41(49)40(48)38(34-45)52-43)37(46)32-30-28-26-24-14-12-10-8-6-4-2/h18-19,30,32,36-38,40-43,45-46,48-50H,3-17,20-29,31,33-35H2,1-2H3,(H,44,47)/b19-18-,32-30+ |
| InChIKey | JMZDLSUCLVMGFL-XUXRLMLDSA-N |
| XLogP | 8.33 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.12 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|