C35H58O15 — CID 138188496
[1-acetyloxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 138188496) has the molecular formula C35H58O15 and a molecular weight of 718.83 g/mol. Its IUPAC name is [1-acetyloxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | [1-acetyloxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 138188496 |
| Molecular Formula | C35H58O15 |
| Molecular Weight | 718.83 g/mol |
| Exact Mass | 718.38 |
| IUPAC Name | [1-acetyloxy-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(COC(C)=O)COC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C35H58O15/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-27(38)48-24(20-45-23(2)37)21-46-34-33(44)31(42)29(40)26(50-34)22-47-35-32(43)30(41)28(39)25(19-36)49-35/h4-5,7-8,10-11,24-26,28-36,39-44H,3,6,9,12-22H2,1-2H3/b5-4-,8-7-,11-10- |
| InChIKey | JRQPQXYHHSFZTP-YSTUJMKBSA-N |
| XLogP | 0.69 |
| TPSA | 231.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.83 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|