C23H25N2PS — CID 1381886
1,3-dibenzyl-5-phenyl-5-sulfanylidene-1,3,5lambda5-diazaphosphinane (PubChem CID 1381886) has the molecular formula C23H25N2PS and a molecular weight of 392.51 g/mol. Its IUPAC name is 1,3-dibenzyl-5-phenyl-5-sulfanylidene-1,3,5lambda5-diazaphosphinane.
| Compound Name | 1,3-dibenzyl-5-phenyl-5-sulfanylidene-1,3,5lambda5-diazaphosphinane |
|---|---|
| PubChem CID | 1381886 |
| Molecular Formula | C23H25N2PS |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1,3-dibenzyl-5-phenyl-5-sulfanylidene-1,3,5lambda5-diazaphosphinane |
| SMILES | S=P1(c2ccccc2)CN(Cc2ccccc2)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H25N2PS/c27-26(23-14-8-3-9-15-23)19-24(16-21-10-4-1-5-11-21)18-25(20-26)17-22-12-6-2-7-13-22/h1-15H,16-20H2 |
| InChIKey | GUWBBROPDZLTGI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|