C20H10N4O6 — CID 1381907
2-(2,4-dioxo-1H-pyrimidin-5-yl)-5-(4-oxo-3,1-benzoxazin-2-yl)isoindole-1,3-dione (PubChem CID 1381907) has the molecular formula C20H10N4O6 and a molecular weight of 402.32 g/mol. Its IUPAC name is 2-(2,4-dioxo-1H-pyrimidin-5-yl)-5-(4-oxo-3,1-benzoxazin-2-yl)isoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxo-1H-pyrimidin-5-yl)-5-(4-oxo-3,1-benzoxazin-2-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 1381907 |
| Molecular Formula | C20H10N4O6 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 2-(2,4-dioxo-1H-pyrimidin-5-yl)-5-(4-oxo-3,1-benzoxazin-2-yl)isoindole-1,3-dione |
| SMILES | O=C1c2ccc(-c3nc4ccccc4c(=O)o3)cc2C(=O)N1c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H10N4O6/c25-15-14(8-21-20(29)23-15)24-17(26)10-6-5-9(7-12(10)18(24)27)16-22-13-4-2-1-3-11(13)19(28)30-16/h1-8H,(H2,21,23,25,29) |
| InChIKey | DFHPOWKMEAHOKE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 146.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|