C49H82O6 — CID 138194169
[3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(9Z,12Z)-pentadeca-9,12-dienoyl]oxypropyl] (Z)-nonadec-9-enoate (PubChem CID 138194169) has the molecular formula C49H82O6 and a molecular weight of 767.19 g/mol. Its IUPAC name is [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(9Z,12Z)-pentadeca-9,12-dienoyl]oxypropyl] (Z)-nonadec-9-enoate.
| Compound Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(9Z,12Z)-pentadeca-9,12-dienoyl]oxypropyl] (Z)-nonadec-9-enoate |
|---|---|
| PubChem CID | 138194169 |
| Molecular Formula | C49H82O6 |
| Molecular Weight | 767.19 g/mol |
| Exact Mass | 766.61 |
| IUPAC Name | [3-[(3Z,6Z,9Z)-dodeca-3,6,9-trienoyl]oxy-2-[(9Z,12Z)-pentadeca-9,12-dienoyl]oxypropyl] (Z)-nonadec-9-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CC(=O)OCC(COC(=O)CCCCCCC/C=C\CCCCCCCCC)OC(=O)CCCCCCC/C=C\C/C=C\CC |
| InChI | InChI=1S/C49H82O6/c1-4-7-10-13-16-19-21-23-24-25-26-28-30-33-36-39-42-48(51)54-45-46(44-53-47(50)41-38-35-32-29-18-15-12-9-6-3)55-49(52)43-40-37-34-31-27-22-20-17-14-11-8-5-2/h8-9,11-12,17-18,20,24-25,29,35,38,46H,4-7,10,13-16,19,21-23,26-28,30-34,36-37,39-45H2,1-3H3/b11-8-,12-9-,20-17-,25-24-,29-18-,38-35- |
| InChIKey | KJERHWNEWMGOGV-JCQIPACVSA-N |
| XLogP | 14.30 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.19 |
| LogP ≤ 5 | 14.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|