C13H19NO — CID 1381986
(4aR,7aS)-1-(2-methylbut-3-yn-2-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyridin-4-one (PubChem CID 1381986) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (4aR,7aS)-1-(2-methylbut-3-yn-2-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyridin-4-one.
| Compound Name | (4aR,7aS)-1-(2-methylbut-3-yn-2-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyridin-4-one |
|---|---|
| PubChem CID | 1381986 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (4aR,7aS)-1-(2-methylbut-3-yn-2-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b]pyridin-4-one |
| SMILES | C#CC(C)(C)N1CCC(=O)[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C13H19NO/c1-4-13(2,3)14-9-8-12(15)10-6-5-7-11(10)14/h1,10-11H,5-9H2,2-3H3/t10-,11+/m1/s1 |
| InChIKey | FZSAALMSLBQPTN-MNOVXSKESA-N |
| XLogP | 1.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|