About 2-amino-4,5-diethoxybenzonitrile
2-amino-4,5-diethoxybenzonitrile (PubChem CID 1381991) has the molecular formula C11H14N2O2
and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-amino-4,5-diethoxybenzonitrile.
Molecular Properties
| Compound Name | 2-amino-4,5-diethoxybenzonitrile |
| PubChem CID | 1381991 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-amino-4,5-diethoxybenzonitrile |
| SMILES | CCOc1cc(N)c(C#N)cc1OCC |
| InChI | InChI=1S/C11H14N2O2/c1-3-14-10-5-8(7-12)9(13)6-11(10)15-4-2/h5-6H,3-4,13H2,1-2H3 |
| InChIKey | RSBNAILPKCDZBJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4,5-diethoxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,5-diethoxybenzonitrile?
The IUPAC name of 2-amino-4,5-diethoxybenzonitrile (CID 1381991) is 2-amino-4,5-diethoxybenzonitrile.
What is the SMILES notation for 2-amino-4,5-diethoxybenzonitrile?
The canonical SMILES for 2-amino-4,5-diethoxybenzonitrile is CCOc1cc(N)c(C#N)cc1OCC.
What is the InChIKey of 2-amino-4,5-diethoxybenzonitrile?
The InChIKey is RSBNAILPKCDZBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-3-14-10-5-8(7-12)9(13)6-11(10)15-4-2/h5-6H,3-4,13H2,1-2H3.
What are the key properties of 2-amino-4,5-diethoxybenzonitrile?
2-amino-4,5-diethoxybenzonitrile has a molecular weight of 206.24 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,5-diethoxybenzonitrile is sourced from PubChem (CID 1381991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).