C22H40O10 — CID 138205310
[1-butanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] nonanoate (PubChem CID 138205310) has the molecular formula C22H40O10 and a molecular weight of 464.55 g/mol. Its IUPAC name is [1-butanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] nonanoate.
| Compound Name | [1-butanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] nonanoate |
|---|---|
| PubChem CID | 138205310 |
| Molecular Formula | C22H40O10 |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | [1-butanoyloxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] nonanoate |
| SMILES | CCCCCCCCC(=O)OC(COC(=O)CCC)COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C22H40O10/c1-3-5-6-7-8-9-11-18(25)31-15(13-29-17(24)10-4-2)14-30-22-21(28)20(27)19(26)16(12-23)32-22/h15-16,19-23,26-28H,3-14H2,1-2H3 |
| InChIKey | LRXFQYKWBCGNPD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|