C33H63NO4 — CID 138205676
(Z)-N-[(E)-1,3-dihydroxypentadec-4-en-2-yl]-3-hydroxyoctadec-11-enamide (PubChem CID 138205676) has the molecular formula C33H63NO4 and a molecular weight of 537.87 g/mol. Its IUPAC name is (Z)-N-[(E)-1,3-dihydroxypentadec-4-en-2-yl]-3-hydroxyoctadec-11-enamide.
| Compound Name | (Z)-N-[(E)-1,3-dihydroxypentadec-4-en-2-yl]-3-hydroxyoctadec-11-enamide |
|---|---|
| PubChem CID | 138205676 |
| Molecular Formula | C33H63NO4 |
| Molecular Weight | 537.87 g/mol |
| Exact Mass | 537.48 |
| IUPAC Name | (Z)-N-[(E)-1,3-dihydroxypentadec-4-en-2-yl]-3-hydroxyoctadec-11-enamide |
| SMILES | CCCCCC/C=C\CCCCCCCC(O)CC(=O)NC(CO)C(O)/C=C/CCCCCCCCCC |
| InChI | InChI=1S/C33H63NO4/c1-3-5-7-9-11-13-15-16-17-18-20-22-24-26-30(36)28-33(38)34-31(29-35)32(37)27-25-23-21-19-14-12-10-8-6-4-2/h13,15,25,27,30-32,35-37H,3-12,14,16-24,26,28-29H2,1-2H3,(H,34,38)/b15-13-,27-25+ |
| InChIKey | LTANEWPSKGIXSG-UAFGXPBGSA-N |
| XLogP | 7.92 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.87 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|