C55H86O6 — CID 138206579
[3-[(6Z,9Z)-dodeca-6,9-dienoyl]oxy-2-[(10Z,12Z)-octadeca-10,12-dienoyl]oxypropyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 138206579) has the molecular formula C55H86O6 and a molecular weight of 843.29 g/mol. Its IUPAC name is [3-[(6Z,9Z)-dodeca-6,9-dienoyl]oxy-2-[(10Z,12Z)-octadeca-10,12-dienoyl]oxypropyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [3-[(6Z,9Z)-dodeca-6,9-dienoyl]oxy-2-[(10Z,12Z)-octadeca-10,12-dienoyl]oxypropyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 138206579 |
| Molecular Formula | C55H86O6 |
| Molecular Weight | 843.29 g/mol |
| Exact Mass | 842.64 |
| IUPAC Name | [3-[(6Z,9Z)-dodeca-6,9-dienoyl]oxy-2-[(10Z,12Z)-octadeca-10,12-dienoyl]oxypropyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OCC(COC(=O)CCCC/C=C\C/C=C\CC)OC(=O)CCCCCCCC/C=C\C=C/CCCCC |
| InChI | InChI=1S/C55H86O6/c1-4-7-10-13-16-19-21-23-25-26-27-28-30-31-33-36-39-42-45-48-54(57)60-51-52(50-59-53(56)47-44-41-38-35-18-15-12-9-6-3)61-55(58)49-46-43-40-37-34-32-29-24-22-20-17-14-11-8-5-2/h7,9-10,12,16-20,22-25,27-28,31,33,35,39,42,52H,4-6,8,11,13-15,21,26,29-30,32,34,36-38,40-41,43-51H2,1-3H3/b10-7-,12-9-,19-16-,20-17-,24-22-,25-23-,28-27-,33-31-,35-18-,42-39- |
| InChIKey | LVSADUHIHYOTFR-KRMXYATASA-N |
| XLogP | 15.75 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.29 |
| LogP ≤ 5 | 15.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|